C17H32O6 — CID 91478022
(2R,5S)-1,2,5,6-tetrahydroxyheptadecane-3,4-dione (PubChem CID 91478022) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2R,5S)-1,2,5,6-tetrahydroxyheptadecane-3,4-dione.
| Compound Name | (2R,5S)-1,2,5,6-tetrahydroxyheptadecane-3,4-dione |
|---|---|
| PubChem CID | 91478022 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (2R,5S)-1,2,5,6-tetrahydroxyheptadecane-3,4-dione |
| SMILES | CCCCCCCCCCCC(O)[C@H](O)C(=O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C17H32O6/c1-2-3-4-5-6-7-8-9-10-11-13(19)15(21)17(23)16(22)14(20)12-18/h13-15,18-21H,2-12H2,1H3/t13?,14-,15+/m1/s1 |
| InChIKey | DCZNSQKXYNISDA-DMJDIKPUSA-N |
| XLogP | 1.12 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|