C9H18O6 — CID 54211027
(3S,4R,5R)-1,3,4,5,6-pentahydroxy-3,4-dimethylheptan-2-one (PubChem CID 54211027) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (3S,4R,5R)-1,3,4,5,6-pentahydroxy-3,4-dimethylheptan-2-one.
| Compound Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxy-3,4-dimethylheptan-2-one |
|---|---|
| PubChem CID | 54211027 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxy-3,4-dimethylheptan-2-one |
| SMILES | CC(O)[C@@H](O)[C@@](C)(O)[C@](C)(O)C(=O)CO |
| InChI | InChI=1S/C9H18O6/c1-5(11)7(13)9(3,15)8(2,14)6(12)4-10/h5,7,10-11,13-15H,4H2,1-3H3/t5?,7-,8-,9-/m1/s1 |
| InChIKey | PVYRDSGEXGYDTE-BSUQUYKDSA-N |
| XLogP | -2.21 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |