C9H14O7 — CID 18760901
2,5-dihydroxy-2-(2-hydroxypropanoyl)-4-oxohexanoic acid (PubChem CID 18760901) has the molecular formula C9H14O7 and a molecular weight of 234.20 g/mol. Its IUPAC name is 2,5-dihydroxy-2-(2-hydroxypropanoyl)-4-oxohexanoic acid.
| Compound Name | 2,5-dihydroxy-2-(2-hydroxypropanoyl)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 18760901 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2,5-dihydroxy-2-(2-hydroxypropanoyl)-4-oxohexanoic acid |
| SMILES | CC(O)C(=O)CC(O)(C(=O)O)C(=O)C(C)O |
| InChI | InChI=1S/C9H14O7/c1-4(10)6(12)3-9(16,8(14)15)7(13)5(2)11/h4-5,10-11,16H,3H2,1-2H3,(H,14,15) |
| InChIKey | HOOUIBMFHVERAN-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|