C6H10O5Zn — CID 157494220
2,4-dihydroxy-2-methyl-3-oxopentanoic acid;zinc (PubChem CID 157494220) has the molecular formula C6H10O5Zn and a molecular weight of 227.53 g/mol. Its IUPAC name is 2,4-dihydroxy-2-methyl-3-oxopentanoic acid;zinc.
| Compound Name | 2,4-dihydroxy-2-methyl-3-oxopentanoic acid;zinc |
|---|---|
| PubChem CID | 157494220 |
| Molecular Formula | C6H10O5Zn |
| Molecular Weight | 227.53 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2,4-dihydroxy-2-methyl-3-oxopentanoic acid;zinc |
| SMILES | CC(O)C(=O)C(C)(O)C(=O)O.[Zn] |
| InChI | InChI=1S/C6H10O5.Zn/c1-3(7)4(8)6(2,11)5(9)10;/h3,7,11H,1-2H3,(H,9,10); |
| InChIKey | BXQBCBDSICIEOD-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.53 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|