C13H23NO6 — CID 140968568
(2S,4S,5S)-2-hydroxy-4-[2-hydroxypropanoyl(methyl)amino]-2,5-dimethyl-3-oxoheptanoic acid (PubChem CID 140968568) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2S,4S,5S)-2-hydroxy-4-[2-hydroxypropanoyl(methyl)amino]-2,5-dimethyl-3-oxoheptanoic acid.
| Compound Name | (2S,4S,5S)-2-hydroxy-4-[2-hydroxypropanoyl(methyl)amino]-2,5-dimethyl-3-oxoheptanoic acid |
|---|---|
| PubChem CID | 140968568 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2S,4S,5S)-2-hydroxy-4-[2-hydroxypropanoyl(methyl)amino]-2,5-dimethyl-3-oxoheptanoic acid |
| SMILES | CC[C@H](C)[C@@H](C(=O)[C@](C)(O)C(=O)O)N(C)C(=O)C(C)O |
| InChI | InChI=1S/C13H23NO6/c1-6-7(2)9(14(5)11(17)8(3)15)10(16)13(4,20)12(18)19/h7-9,15,20H,6H2,1-5H3,(H,18,19)/t7-,8?,9-,13-/m0/s1 |
| InChIKey | WLBUIDMNOMFHMJ-CSQKOBRTSA-N |
| XLogP | -0.35 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|