C25H43N3O10 — CID 139993404
(2R,4R,6S)-9-amino-4-[(2S)-butan-2-yl]-6-(dimethylamino)-2-hydroxy-6-[(2S)-2-hydroxypropanoyl]-4-[[(2R)-2-hydroxypropanoyl]-methylamino]-2-methyl-3,5,8-trioxoundecanoic acid (PubChem CID 139993404) has the molecular formula C25H43N3O10 and a molecular weight of 545.63 g/mol. Its IUPAC name is (2R,4R,6S)-9-amino-4-[(2S)-butan-2-yl]-6-(dimethylamino)-2-hydroxy-6-[(2S)-2-hydroxypropanoyl]-4-[[(2R)-2-hydroxypropanoyl]-methylamino]-2-methyl-3,5,8-trioxoundecanoic acid.
| Compound Name | (2R,4R,6S)-9-amino-4-[(2S)-butan-2-yl]-6-(dimethylamino)-2-hydroxy-6-[(2S)-2-hydroxypropanoyl]-4-[[(2R)-2-hydroxypropanoyl]-methylamino]-2-methyl-3,5,8-trioxoundecanoic acid |
|---|---|
| PubChem CID | 139993404 |
| Molecular Formula | C25H43N3O10 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (2R,4R,6S)-9-amino-4-[(2S)-butan-2-yl]-6-(dimethylamino)-2-hydroxy-6-[(2S)-2-hydroxypropanoyl]-4-[[(2R)-2-hydroxypropanoyl]-methylamino]-2-methyl-3,5,8-trioxoundecanoic acid |
| SMILES | CCC(N)C(=O)C[C@@](C(=O)[C@H](C)O)(C(=O)[C@@](C(=O)[C@@](C)(O)C(=O)O)([C@@H](C)CC)N(C)C(=O)[C@@H](C)O)N(C)C |
| InChI | InChI=1S/C25H43N3O10/c1-10-13(3)25(28(9)19(33)15(5)30,20(34)23(6,38)22(36)37)21(35)24(27(7)8,18(32)14(4)29)12-17(31)16(26)11-2/h13-16,29-30,38H,10-12,26H2,1-9H3,(H,36,37)/t13-,14-,15+,16?,23+,24+,25-/m0/s1 |
| InChIKey | STYQHVBTLLFCNQ-IQZWMLFLSA-N |
| XLogP | -1.47 |
| TPSA | 215.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|