C12H23NO4 — CID 88778862
(2R,3S)-2-hydroxy-3-methyl-2-[methyl(3-methylbutanoyl)amino]pentanoic acid (PubChem CID 88778862) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2R,3S)-2-hydroxy-3-methyl-2-[methyl(3-methylbutanoyl)amino]pentanoic acid.
| Compound Name | (2R,3S)-2-hydroxy-3-methyl-2-[methyl(3-methylbutanoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 88778862 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (2R,3S)-2-hydroxy-3-methyl-2-[methyl(3-methylbutanoyl)amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@@](O)(C(=O)O)N(C)C(=O)CC(C)C |
| InChI | InChI=1S/C12H23NO4/c1-6-9(4)12(17,11(15)16)13(5)10(14)7-8(2)3/h8-9,17H,6-7H2,1-5H3,(H,15,16)/t9-,12+/m0/s1 |
| InChIKey | DHNIGOYTPIYFKL-JOYOIKCWSA-N |
| XLogP | 1.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|