C9H18ClNO — CID 104555865
N-(1-chloropropan-2-yl)-N,3-dimethylbutanamide (PubChem CID 104555865) has the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N,3-dimethylbutanamide.
| Compound Name | N-(1-chloropropan-2-yl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 104555865 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)C(C)CCl |
| InChI | InChI=1S/C9H18ClNO/c1-7(2)5-9(12)11(4)8(3)6-10/h7-8H,5-6H2,1-4H3 |
| InChIKey | UBJPCKOOTFJLPK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|