C8H16ClNO — CID 104555861
N-(1-chloropropan-2-yl)-N,2-dimethylpropanamide (PubChem CID 104555861) has the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N,2-dimethylpropanamide.
| Compound Name | N-(1-chloropropan-2-yl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 104555861 |
| Molecular Formula | C8H16ClNO |
| Molecular Weight | 177.67 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)C(C)CCl |
| InChI | InChI=1S/C8H16ClNO/c1-6(2)8(11)10(4)7(3)5-9/h6-7H,5H2,1-4H3 |
| InChIKey | LDEFGYNTNPXZSN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.67 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|