C24H36N2O7 — CID 67719146
(6S)-6-[benzyl(methyl)amino]-2,4-dihydroxy-4,7-dimethyl-2-[(3S)-3-(methylamino)-2-oxobutyl]-3,5-dioxononanoic acid (PubChem CID 67719146) has the molecular formula C24H36N2O7 and a molecular weight of 464.56 g/mol. Its IUPAC name is (6S)-6-[benzyl(methyl)amino]-2,4-dihydroxy-4,7-dimethyl-2-[(3S)-3-(methylamino)-2-oxobutyl]-3,5-dioxononanoic acid.
| Compound Name | (6S)-6-[benzyl(methyl)amino]-2,4-dihydroxy-4,7-dimethyl-2-[(3S)-3-(methylamino)-2-oxobutyl]-3,5-dioxononanoic acid |
|---|---|
| PubChem CID | 67719146 |
| Molecular Formula | C24H36N2O7 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (6S)-6-[benzyl(methyl)amino]-2,4-dihydroxy-4,7-dimethyl-2-[(3S)-3-(methylamino)-2-oxobutyl]-3,5-dioxononanoic acid |
| SMILES | CCC(C)[C@@H](C(=O)C(C)(O)C(=O)C(O)(CC(=O)[C@H](C)NC)C(=O)O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H36N2O7/c1-7-15(2)19(26(6)14-17-11-9-8-10-12-17)20(28)23(4,32)21(29)24(33,22(30)31)13-18(27)16(3)25-5/h8-12,15-16,19,25,32-33H,7,13-14H2,1-6H3,(H,30,31)/t15?,16-,19-,23?,24?/m0/s1 |
| InChIKey | ZLXSYMKEZDCGCB-ABMLTAGOSA-N |
| XLogP | 0.81 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|