C11H22INO4 — CID 21153206
(2,4-dihydroxy-3-oxo-2-propanoylpentyl)-trimethylazanium iodide (PubChem CID 21153206) has the molecular formula C11H22INO4 and a molecular weight of 359.20 g/mol. Its IUPAC name is (2,4-dihydroxy-3-oxo-2-propanoylpentyl)-trimethylazanium iodide.
| Compound Name | (2,4-dihydroxy-3-oxo-2-propanoylpentyl)-trimethylazanium iodide |
|---|---|
| PubChem CID | 21153206 |
| Molecular Formula | C11H22INO4 |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (2,4-dihydroxy-3-oxo-2-propanoylpentyl)-trimethylazanium iodide |
| SMILES | CCC(=O)C(O)(C[N+](C)(C)C)C(=O)C(C)O.[I-] |
| InChI | InChI=1S/C11H22NO4.HI/c1-6-9(14)11(16,7-12(3,4)5)10(15)8(2)13;/h8,13,16H,6-7H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | UKLUQGRSUOGLDL-UHFFFAOYSA-M |
| XLogP | -3.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|