C10H16NO9+ — CID 141084760
trimethyl-(2,3,3,3-tetracarboxy-2-hydroxypropyl)azanium (PubChem CID 141084760) has the molecular formula C10H16NO9+ and a molecular weight of 294.24 g/mol. Its IUPAC name is trimethyl-(2,3,3,3-tetracarboxy-2-hydroxypropyl)azanium.
| Compound Name | trimethyl-(2,3,3,3-tetracarboxy-2-hydroxypropyl)azanium |
|---|---|
| PubChem CID | 141084760 |
| Molecular Formula | C10H16NO9+ |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | trimethyl-(2,3,3,3-tetracarboxy-2-hydroxypropyl)azanium |
| SMILES | C[N+](C)(C)CC(O)(C(=O)O)C(C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15NO9/c1-11(2,3)4-9(20,5(12)13)10(6(14)15,7(16)17)8(18)19/h20H,4H2,1-3H3,(H3-,12,13,14,15,16,17,18,19)/p+1 |
| InChIKey | GCKCYUCWEUPKKI-UHFFFAOYSA-O |
| XLogP | -2.25 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|