C8H15NO5 — CID 141284408
3,4-dihydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]butanoate (PubChem CID 141284408) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3,4-dihydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]butanoate.
| Compound Name | 3,4-dihydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]butanoate |
|---|---|
| PubChem CID | 141284408 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 3,4-dihydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]butanoate |
| SMILES | C[N+](C)(C)CC(O)(CC(=O)[O-])C(=O)O |
| InChI | InChI=1S/C8H15NO5/c1-9(2,3)5-8(14,7(12)13)4-6(10)11/h14H,4-5H2,1-3H3,(H-,10,11,12,13) |
| InChIKey | XPTZBHGJHKGSAD-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|