C11H18LiNO6 — CID 172857087
lithium (3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanedioate (PubChem CID 172857087) has the molecular formula C11H18LiNO6 and a molecular weight of 267.21 g/mol. Its IUPAC name is lithium (3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanedioate.
| Compound Name | lithium (3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanedioate |
|---|---|
| PubChem CID | 172857087 |
| Molecular Formula | C11H18LiNO6 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | lithium (3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanedioate |
| SMILES | C[N+](C)(C)C[C@](O)(CC(=O)[O-])C(=O)CCC(=O)[O-].[Li+] |
| InChI | InChI=1S/C11H19NO6.Li/c1-12(2,3)7-11(18,6-10(16)17)8(13)4-5-9(14)15;/h18H,4-7H2,1-3H3,(H-,14,15,16,17);/q;+1/p-1/t11-;/m1./s1 |
| InChIKey | YVULNHDMRWVEPZ-RFVHGSKJSA-M |
| XLogP | -6.33 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|