C15H27NO6 — CID 151391469
3,11-dihydroxy-4,11-dioxo-3-[(trimethylazaniumyl)methyl]undecanoate (PubChem CID 151391469) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 3,11-dihydroxy-4,11-dioxo-3-[(trimethylazaniumyl)methyl]undecanoate.
| Compound Name | 3,11-dihydroxy-4,11-dioxo-3-[(trimethylazaniumyl)methyl]undecanoate |
|---|---|
| PubChem CID | 151391469 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 3,11-dihydroxy-4,11-dioxo-3-[(trimethylazaniumyl)methyl]undecanoate |
| SMILES | C[N+](C)(C)CC(O)(CC(=O)[O-])C(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C15H27NO6/c1-16(2,3)11-15(22,10-14(20)21)12(17)8-6-4-5-7-9-13(18)19/h22H,4-11H2,1-3H3,(H-,18,19,20,21) |
| InChIKey | OUNNGCTUJNCTSR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|