C13H25NO7 — CID 175868821
3-hydroxybutanoic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate (PubChem CID 175868821) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-hydroxybutanoic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate.
| Compound Name | 3-hydroxybutanoic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
|---|---|
| PubChem CID | 175868821 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-hydroxybutanoic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
| SMILES | CC(=O)[C@@](O)(CC(=O)[O-])C[N+](C)(C)C.CC(O)CC(=O)O |
| InChI | InChI=1S/C9H17NO4.C4H8O3/c1-7(11)9(14,5-8(12)13)6-10(2,3)4;1-3(5)2-4(6)7/h14H,5-6H2,1-4H3;3,5H,2H2,1H3,(H,6,7)/t9-;/m1./s1 |
| InChIKey | QUTFLMYDMWNQJF-SBSPUUFOSA-N |
| XLogP | -2.01 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|