C15H25MgNO11 — CID 131851310
CID 131851310 (PubChem CID 131851310) has the molecular formula C15H25MgNO11 and a molecular weight of 419.67 g/mol.
| Compound Name | CID 131851310 |
|---|---|
| PubChem CID | 131851310 |
| Molecular Formula | C15H25MgNO11 |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.O=C([O-])CC(O)(CC(=O)O)C(=O)O.[Mg] |
| InChI | InChI=1S/C9H17NO4.C6H8O7.Mg/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;7-3(8)1-6(13,5(11)12)2-4(9)10;/h8H,5-6H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/t8-;;/m1../s1 |
| InChIKey | CSWMFRNKHXHQOP-YCBDHFTFSA-N |
| XLogP | -2.87 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|