C13H22NO9+ — CID 71773451
[(2R)-3-carboxy-2-(3,4-dicarboxy-3-hydroxybutanoyl)oxypropyl]-trimethylazanium (PubChem CID 71773451) has the molecular formula C13H22NO9+ and a molecular weight of 336.32 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-(3,4-dicarboxy-3-hydroxybutanoyl)oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-(3,4-dicarboxy-3-hydroxybutanoyl)oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 71773451 |
| Molecular Formula | C13H22NO9+ |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [(2R)-3-carboxy-2-(3,4-dicarboxy-3-hydroxybutanoyl)oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO9/c1-14(2,3)7-8(4-9(15)16)23-11(19)6-13(22,12(20)21)5-10(17)18/h8,22H,4-7H2,1-3H3,(H2-,15,16,17,18,20,21)/p+1/t8-,13?/m1/s1 |
| InChIKey | ZHLUVDBSXKUKNQ-UOGPZTOASA-O |
| XLogP | -1.24 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|