C13H21NO8 — CID 158171319
but-2-enedioic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate (PubChem CID 158171319) has the molecular formula C13H21NO8 and a molecular weight of 319.31 g/mol. Its IUPAC name is but-2-enedioic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate.
| Compound Name | but-2-enedioic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
|---|---|
| PubChem CID | 158171319 |
| Molecular Formula | C13H21NO8 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | but-2-enedioic acid;(3R)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
| SMILES | CC(=O)[C@@](O)(CC(=O)[O-])C[N+](C)(C)C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C9H17NO4.C4H4O4/c1-7(11)9(14,5-8(12)13)6-10(2,3)4;5-3(6)1-2-4(7)8/h14H,5-6H2,1-4H3;1-2H,(H,5,6)(H,7,8)/t9-;/m1./s1 |
| InChIKey | FXMGCAULAFEKSO-SBSPUUFOSA-N |
| XLogP | -2.14 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|