C18H34N2O8 — CID 159794166
3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate (PubChem CID 159794166) has the molecular formula C18H34N2O8 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate.
| Compound Name | 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
|---|---|
| PubChem CID | 159794166 |
| Molecular Formula | C18H34N2O8 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate |
| SMILES | CC(=O)C(O)(CC(=O)[O-])C[N+](C)(C)C.CC(=O)C(O)(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/2C9H17NO4/c2*1-7(11)9(14,5-8(12)13)6-10(2,3)4/h2*14H,5-6H2,1-4H3 |
| InChIKey | NIYKKCOCGMKWDY-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|