C12H22ClNO6 — CID 157226542
3-hydroxy-7-methoxy-4,7-dioxo-3-[(trimethylazaniumyl)methyl]heptanoate;hydrochloride (PubChem CID 157226542) has the molecular formula C12H22ClNO6 and a molecular weight of 311.76 g/mol. Its IUPAC name is 3-hydroxy-7-methoxy-4,7-dioxo-3-[(trimethylazaniumyl)methyl]heptanoate;hydrochloride.
| Compound Name | 3-hydroxy-7-methoxy-4,7-dioxo-3-[(trimethylazaniumyl)methyl]heptanoate;hydrochloride |
|---|---|
| PubChem CID | 157226542 |
| Molecular Formula | C12H22ClNO6 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-hydroxy-7-methoxy-4,7-dioxo-3-[(trimethylazaniumyl)methyl]heptanoate;hydrochloride |
| SMILES | COC(=O)CCC(=O)C(O)(CC(=O)[O-])C[N+](C)(C)C.Cl |
| InChI | InChI=1S/C12H21NO6.ClH/c1-13(2,3)8-12(18,7-10(15)16)9(14)5-6-11(17)19-4;/h18H,5-8H2,1-4H3;1H |
| InChIKey | XKLWZZHMRWCFNF-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|