C11H20F3N2O4- — CID 131713488
3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate;2,2,2-trifluoroethylazanide (PubChem CID 131713488) has the molecular formula C11H20F3N2O4- and a molecular weight of 301.29 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate;2,2,2-trifluoroethylazanide.
| Compound Name | 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate;2,2,2-trifluoroethylazanide |
|---|---|
| PubChem CID | 131713488 |
| Molecular Formula | C11H20F3N2O4- |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]pentanoate;2,2,2-trifluoroethylazanide |
| SMILES | CC(=O)C(O)(CC(=O)[O-])C[N+](C)(C)C.[NH-]CC(F)(F)F |
| InChI | InChI=1S/C9H17NO4.C2H3F3N/c1-7(11)9(14,5-8(12)13)6-10(2,3)4;3-2(4,5)1-6/h14H,5-6H2,1-4H3;6H,1H2/q;-1 |
| InChIKey | ZTDJFPXPWVYDOK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|