C7H18N2O6P+ — CID 141198754
[3-carboxy-2-hydroxy-2-(phosphonoamino)propyl]-trimethylazanium (PubChem CID 141198754) has the molecular formula C7H18N2O6P+ and a molecular weight of 257.20 g/mol. Its IUPAC name is [3-carboxy-2-hydroxy-2-(phosphonoamino)propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-hydroxy-2-(phosphonoamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 141198754 |
| Molecular Formula | C7H18N2O6P+ |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [3-carboxy-2-hydroxy-2-(phosphonoamino)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)(CC(=O)O)NP(=O)(O)O |
| InChI | InChI=1S/C7H17N2O6P/c1-9(2,3)5-7(12,4-6(10)11)8-16(13,14)15/h12H,4-5H2,1-3H3,(H3-,8,10,11,13,14,15)/p+1 |
| InChIKey | FZUUPFVNJITTNN-UHFFFAOYSA-O |
| XLogP | -1.46 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|