C9H19NO5P+ — CID 87788191
(2-hydroxy-4-methyl-3-oxo-2-phosphonopent-4-enyl)-trimethylazanium (PubChem CID 87788191) has the molecular formula C9H19NO5P+ and a molecular weight of 252.23 g/mol. Its IUPAC name is (2-hydroxy-4-methyl-3-oxo-2-phosphonopent-4-enyl)-trimethylazanium.
| Compound Name | (2-hydroxy-4-methyl-3-oxo-2-phosphonopent-4-enyl)-trimethylazanium |
|---|---|
| PubChem CID | 87788191 |
| Molecular Formula | C9H19NO5P+ |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (2-hydroxy-4-methyl-3-oxo-2-phosphonopent-4-enyl)-trimethylazanium |
| SMILES | C=C(C)C(=O)C(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C9H18NO5P/c1-7(2)8(11)9(12,16(13,14)15)6-10(3,4)5/h12H,1,6H2,2-5H3,(H-,13,14,15)/p+1 |
| InChIKey | QBQUDOHAORETEI-UHFFFAOYSA-O |
| XLogP | -0.30 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|