C29H59NO4P+ — CID 87062583
[(6Z,15Z)-2-hydroxy-2-phosphonohexacosa-6,15-dienyl]-trimethylazanium (PubChem CID 87062583) has the molecular formula C29H59NO4P+ and a molecular weight of 516.77 g/mol. Its IUPAC name is [(6Z,15Z)-2-hydroxy-2-phosphonohexacosa-6,15-dienyl]-trimethylazanium.
| Compound Name | [(6Z,15Z)-2-hydroxy-2-phosphonohexacosa-6,15-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062583 |
| Molecular Formula | C29H59NO4P+ |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | [(6Z,15Z)-2-hydroxy-2-phosphonohexacosa-6,15-dienyl]-trimethylazanium |
| SMILES | CCCCCCCCCC/C=C\CCCCCCC/C=C\CCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C29H58NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-29(31,35(32,33)34)28-30(2,3)4/h14-15,23-24,31H,5-13,16-22,25-28H2,1-4H3,(H-,32,33,34)/p+1/b15-14-,24-23- |
| InChIKey | LFEHSJKAKHLVDE-RXVOPHRDSA-O |
| XLogP | 8.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|