C23H48O5Si2 — CID 71024078
(2R,3R,4R,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-5-tri(propan-2-yl)silyloxycycloheptan-1-one (PubChem CID 71024078) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is (2R,3R,4R,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-5-tri(propan-2-yl)silyloxycycloheptan-1-one.
| Compound Name | (2R,3R,4R,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-5-tri(propan-2-yl)silyloxycycloheptan-1-one |
|---|---|
| PubChem CID | 71024078 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R,3R,4R,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-5-tri(propan-2-yl)silyloxycycloheptan-1-one |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H](O)[C@H](O)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H48O5Si2/c1-14(2)30(15(3)4,16(5)6)28-18-13-19(27-29(11,12)23(8,9)10)21(25)22(26)20(24)17(18)7/h14-20,22,24,26H,13H2,1-12H3/t17-,18-,19-,20+,22+/m0/s1 |
| InChIKey | VYXIEVZAEAMJIN-YIUJWAEMSA-N |
| XLogP | 5.27 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|