C27H60O4Si3 — CID 11272575
(2R,3S,4S,5S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanal (PubChem CID 11272575) has the molecular formula C27H60O4Si3 and a molecular weight of 533.03 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanal.
| Compound Name | (2R,3S,4S,5S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanal |
|---|---|
| PubChem CID | 11272575 |
| Molecular Formula | C27H60O4Si3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (2R,3S,4S,5S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanal |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H60O4Si3/c1-21(20-28)24(31-34(16,17)27(9,10)11)22(2)23(30-33(14,15)26(6,7)8)18-19-29-32(12,13)25(3,4)5/h20-24H,18-19H2,1-17H3/t21-,22-,23-,24+/m0/s1 |
| InChIKey | ZUFZRPOAQWAWLD-NEWJYFPISA-N |
| XLogP | 8.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|