C21H46O4Si2 — CID 54577935
(3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyl-3-triethylsilyloxyheptanal (PubChem CID 54577935) has the molecular formula C21H46O4Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is (3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyl-3-triethylsilyloxyheptanal.
| Compound Name | (3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyl-3-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 54577935 |
| Molecular Formula | C21H46O4Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3R,4R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyl-3-triethylsilyloxyheptanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=O)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C21H46O4Si2/c1-11-27(12-2,13-3)25-19(15-17-22)21(7,23-8)16-14-18-24-26(9,10)20(4,5)6/h17,19H,11-16,18H2,1-10H3/t19-,21-/m1/s1 |
| InChIKey | RIWBMEKQUFEGEX-TZIWHRDSSA-N |
| XLogP | 6.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|