C22H46O4Si2 — CID 135024173
2-[tert-butyl(dimethyl)silyl]oxy-2-[(5R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2-methyloxolan-2-yl]acetaldehyde (PubChem CID 135024173) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-[(5R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2-methyloxolan-2-yl]acetaldehyde.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[(5R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2-methyloxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 135024173 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[(5R)-5-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2-methyloxolan-2-yl]acetaldehyde |
| SMILES | CC1(C(C=O)O[Si](C)(C)C(C)(C)C)CC[C@H](C(C)(C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H46O4Si2/c1-19(2,3)27(10,11)25-18(16-23)22(9)15-14-17(24-22)21(7,8)26-28(12,13)20(4,5)6/h16-18H,14-15H2,1-13H3/t17-,18?,22?/m1/s1 |
| InChIKey | ILLHOSYLUKFUQM-PDDLGQBUSA-N |
| XLogP | 6.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|