C21H44O4Si2 — CID 11304605
(2S)-2-[(2R,4R,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyloxolan-2-yl]-2-triethylsilyloxyacetaldehyde (PubChem CID 11304605) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is (2S)-2-[(2R,4R,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyloxolan-2-yl]-2-triethylsilyloxyacetaldehyde.
| Compound Name | (2S)-2-[(2R,4R,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyloxolan-2-yl]-2-triethylsilyloxyacetaldehyde |
|---|---|
| PubChem CID | 11304605 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (2S)-2-[(2R,4R,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyloxolan-2-yl]-2-triethylsilyloxyacetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H](C=O)[C@H]1C[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H44O4Si2/c1-10-27(11-2,12-3)25-20(16-22)19-15-17(4)18(24-19)13-14-23-26(8,9)21(5,6)7/h16-20H,10-15H2,1-9H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | AEDLFPKVLMXQLN-IYWMVGAKSA-N |
| XLogP | 5.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|