C26H56O5Si3 — CID 25107871
(2S,3R,5R)-5-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2-carbaldehyde (PubChem CID 25107871) has the molecular formula C26H56O5Si3 and a molecular weight of 532.99 g/mol. Its IUPAC name is (2S,3R,5R)-5-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2-carbaldehyde.
| Compound Name | (2S,3R,5R)-5-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 25107871 |
| Molecular Formula | C26H56O5Si3 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (2S,3R,5R)-5-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O1 |
| InChI | InChI=1S/C26H56O5Si3/c1-23(2,3)32(11,12)28-19-22(31-34(15,16)25(7,8)9)26(10)17-20(21(18-27)29-26)30-33(13,14)24(4,5)6/h18,20-22H,17,19H2,1-16H3/t20-,21-,22+,26-/m1/s1 |
| InChIKey | ZCESTPSONPBBHM-ZUVQJFRASA-N |
| XLogP | 7.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|