C19H38O5Si2 — CID 10621168
(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2R)-5-oxooxolan-2-yl]propanal (PubChem CID 10621168) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2R)-5-oxooxolan-2-yl]propanal.
| Compound Name | (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2R)-5-oxooxolan-2-yl]propanal |
|---|---|
| PubChem CID | 10621168 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2R)-5-oxooxolan-2-yl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]([C@@H](C=O)O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C19H38O5Si2/c1-18(2,3)25(7,8)23-15(13-20)17(14-11-12-16(21)22-14)24-26(9,10)19(4,5)6/h13-15,17H,11-12H2,1-10H3/t14-,15-,17+/m1/s1 |
| InChIKey | QAVUUELPMDTQOY-INMHGKMJSA-N |
| XLogP | 4.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|