C27H58O5Si3 — CID 135665369
(2R)-2-[(3S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propanal (PubChem CID 135665369) has the molecular formula C27H58O5Si3 and a molecular weight of 547.01 g/mol. Its IUPAC name is (2R)-2-[(3S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propanal.
| Compound Name | (2R)-2-[(3S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propanal |
|---|---|
| PubChem CID | 135665369 |
| Molecular Formula | C27H58O5Si3 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (2R)-2-[(3S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propanal |
| SMILES | C[C@@H](C=O)C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H58O5Si3/c1-20(18-28)24-22(32-35(15,16)27(8,9)10)17-21(31-34(13,14)26(5,6)7)23(30-24)19-29-33(11,12)25(2,3)4/h18,20-24H,17,19H2,1-16H3/t20-,21+,22-,23+,24?/m0/s1 |
| InChIKey | OPTJYOSJXQJYFX-WBMBYIAYSA-N |
| XLogP | 7.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|