C19H36O5Si — CID 135079130
(2R)-2-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]propanal (PubChem CID 135079130) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (2R)-2-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]propanal.
| Compound Name | (2R)-2-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]propanal |
|---|---|
| PubChem CID | 135079130 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R)-2-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]propanal |
| SMILES | C[C@@H](C=O)[C@@H]1O[C@@H]2CCOC(C)(C)O[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O5Si/c1-13(12-20)17-16(24-25(7,8)18(2,3)4)11-15-14(22-17)9-10-21-19(5,6)23-15/h12-17H,9-11H2,1-8H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | PVXRRPOBQLFSBY-BIVLZKPYSA-N |
| XLogP | 3.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|