C20H40O4Si — CID 11234125
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]propanal (PubChem CID 11234125) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]propanal.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]propanal |
|---|---|
| PubChem CID | 11234125 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]propanal |
| SMILES | CCCCC[C@H]1OC(C)(C)OC[C@H]1[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-9-10-11-12-17-16(15-22-20(5,6)23-17)18(13-14-21)24-25(7,8)19(2,3)4/h14,16-18H,9-13,15H2,1-8H3/t16-,17-,18+/m1/s1 |
| InChIKey | PIKHPEGVFNLXKI-KURKYZTESA-N |
| XLogP | 5.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|