C26H52O6Si2 — CID 10907405
2-[(2S,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxan-2-yl]acetaldehyde (PubChem CID 10907405) has the molecular formula C26H52O6Si2 and a molecular weight of 516.87 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10907405 |
| Molecular Formula | C26H52O6Si2 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 2-[(2S,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxan-2-yl]acetaldehyde |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC=O)O[C@@H](C[C@@H]2COC(C)(C)O2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O6Si2/c1-18-22(31-33(10,11)24(2,3)4)20(14-15-27)29-21(16-19-17-28-26(8,9)30-19)23(18)32-34(12,13)25(5,6)7/h15,18-23H,14,16-17H2,1-13H3/t18-,19-,20+,21+,22-,23+/m1/s1 |
| InChIKey | OIWXXWARKBENHN-AZZQQCEESA-N |
| XLogP | 6.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|