C23H42O6Si — CID 11316679
1-[(1S,3R,8S,11R,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,6,13-trimethyl-2,5,7,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-13-yl]propan-2-one (PubChem CID 11316679) has the molecular formula C23H42O6Si and a molecular weight of 442.67 g/mol. Its IUPAC name is 1-[(1S,3R,8S,11R,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,6,13-trimethyl-2,5,7,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-13-yl]propan-2-one.
| Compound Name | 1-[(1S,3R,8S,11R,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,6,13-trimethyl-2,5,7,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-13-yl]propan-2-one |
|---|---|
| PubChem CID | 11316679 |
| Molecular Formula | C23H42O6Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[(1S,3R,8S,11R,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,6,13-trimethyl-2,5,7,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-13-yl]propan-2-one |
| SMILES | CC(=O)C[C@]1(C)O[C@@H]2CC[C@@H]3OC(C)(C)OC[C@H]3O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O6Si/c1-15(24)13-23(7)20(29-30(8,9)21(2,3)4)12-18-16(28-23)10-11-17-19(26-18)14-25-22(5,6)27-17/h16-20H,10-14H2,1-9H3/t16-,17+,18+,19-,20-,23+/m1/s1 |
| InChIKey | YSTGGQNLSGDNRY-AGKSVDAPSA-N |
| XLogP | 4.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|