C28H54O6Si2 — CID 10907677
2-[(4S,6S,8S,10R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde (PubChem CID 10907677) has the molecular formula C28H54O6Si2 and a molecular weight of 542.91 g/mol. Its IUPAC name is 2-[(4S,6S,8S,10R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde.
| Compound Name | 2-[(4S,6S,8S,10R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde |
|---|---|
| PubChem CID | 10907677 |
| Molecular Formula | C28H54O6Si2 |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 2-[(4S,6S,8S,10R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC[C@]2(CC[C@]3(O[C@@H](CC=O)CC[C@]3(C)O[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C28H54O6Si2/c1-24(2,3)35(8,9)30-21-23-13-12-16-27(31-23)18-19-28(33-27)26(7,17-14-22(32-28)15-20-29)34-36(10,11)25(4,5)6/h20,22-23H,12-19,21H2,1-11H3/t22-,23+,26+,27+,28+/m1/s1 |
| InChIKey | MXPBFNJBKKRJAM-XBMNHCDJSA-N |
| XLogP | 7.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|