C27H52O4Si — CID 11190578
(2S)-2-methyl-4-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butanal (PubChem CID 11190578) has the molecular formula C27H52O4Si and a molecular weight of 468.80 g/mol. Its IUPAC name is (2S)-2-methyl-4-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butanal.
| Compound Name | (2S)-2-methyl-4-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butanal |
|---|---|
| PubChem CID | 11190578 |
| Molecular Formula | C27H52O4Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | (2S)-2-methyl-4-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undecan-8-yl]butanal |
| SMILES | CC(C)[Si](OCCC[C@H]1O[C@@]2(CCC[C@@H](CC[C@H](C)C=O)O2)CC[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O4Si/c1-20(2)32(21(3)4,22(5)6)29-18-10-12-26-24(8)15-17-27(31-26)16-9-11-25(30-27)14-13-23(7)19-28/h19-26H,9-18H2,1-8H3/t23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | VKWYYAWITQTVGY-JUCVYKANSA-N |
| XLogP | 7.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|