C25H46O7Si — CID 134974030
methyl 2-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-methoxy-3-methylcyclopropane-1-carboxylate (PubChem CID 134974030) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is methyl 2-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-methoxy-3-methylcyclopropane-1-carboxylate.
| Compound Name | methyl 2-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-methoxy-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134974030 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | methyl 2-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-methoxy-3-methylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1C(C)C1(OC)[C@H]1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2OC(C)(C)OCC2O1 |
| InChI | InChI=1S/C25H46O7Si/c1-14(2)33(15(3)4,16(5)6)32-18-12-20(25(28-11)17(7)21(25)23(26)27-10)30-19-13-29-24(8,9)31-22(18)19/h14-22H,12-13H2,1-11H3/t17?,18-,19?,20-,21?,22+,25?/m1/s1 |
| InChIKey | RHIRLQOWMWRZMN-XLWZPUPASA-N |
| XLogP | 4.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|