C24H42O7Si — CID 134974004
6-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-6-methoxy-2-oxabicyclo[3.1.0]hexan-3-one (PubChem CID 134974004) has the molecular formula C24H42O7Si and a molecular weight of 470.68 g/mol. Its IUPAC name is 6-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-6-methoxy-2-oxabicyclo[3.1.0]hexan-3-one.
| Compound Name | 6-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-6-methoxy-2-oxabicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 134974004 |
| Molecular Formula | C24H42O7Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 6-[(6R,8R,8aR)-2,2-dimethyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-6-methoxy-2-oxabicyclo[3.1.0]hexan-3-one |
| SMILES | COC1([C@H]2C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]3OC(C)(C)OCC3O2)C2CC(=O)OC21 |
| InChI | InChI=1S/C24H42O7Si/c1-13(2)32(14(3)4,15(5)6)31-17-11-19(24(26-9)16-10-20(25)29-22(16)24)28-18-12-27-23(7,8)30-21(17)18/h13-19,21-22H,10-12H2,1-9H3/t16?,17-,18?,19-,21+,22?,24?/m1/s1 |
| InChIKey | ZNMJNLRBZSKLMZ-GYBXGUAHSA-N |
| XLogP | 4.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|