C19H34O6Si — CID 11069112
ethyl (1R,2S,3S,4S,6R,7R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-5,8,10-trioxatricyclo[5.3.0.02,4]decane-3-carboxylate (PubChem CID 11069112) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is ethyl (1R,2S,3S,4S,6R,7R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-5,8,10-trioxatricyclo[5.3.0.02,4]decane-3-carboxylate.
| Compound Name | ethyl (1R,2S,3S,4S,6R,7R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-5,8,10-trioxatricyclo[5.3.0.02,4]decane-3-carboxylate |
|---|---|
| PubChem CID | 11069112 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | ethyl (1R,2S,3S,4S,6R,7R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-5,8,10-trioxatricyclo[5.3.0.02,4]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]3OC(C)(C)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C19H34O6Si/c1-9-21-17(20)13-12-15(13)23-11(10-22-26(7,8)18(2,3)4)14-16(12)25-19(5,6)24-14/h11-16H,9-10H2,1-8H3/t11-,12+,13+,14+,15+,16-/m1/s1 |
| InChIKey | ZXKXDLZPTXESOI-QOTRURMSSA-N |
| XLogP | 3.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|