C18H29FO6Si — CID 101255573
[(1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-8-oxo-3,7-dioxatricyclo[4.3.0.02,9]nonan-4-yl]methyl acetate (PubChem CID 101255573) has the molecular formula C18H29FO6Si and a molecular weight of 388.51 g/mol. Its IUPAC name is [(1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-8-oxo-3,7-dioxatricyclo[4.3.0.02,9]nonan-4-yl]methyl acetate.
| Compound Name | [(1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-8-oxo-3,7-dioxatricyclo[4.3.0.02,9]nonan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 101255573 |
| Molecular Formula | C18H29FO6Si |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-8-oxo-3,7-dioxatricyclo[4.3.0.02,9]nonan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2C3C(=O)O[C@@H]([C@@H]1O[Si](F)(C(C)(C)C)C(C)(C)C)[C@H]32 |
| InChI | InChI=1S/C18H29FO6Si/c1-9(20)22-8-10-13(15-11-12(14(11)23-10)16(21)24-15)25-26(19,17(2,3)4)18(5,6)7/h10-15H,8H2,1-7H3/t10-,11-,12?,13-,14-,15-/m1/s1 |
| InChIKey | ZWDLCSPHIDRRSG-BDKZPBHDSA-N |
| XLogP | 2.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|