C16H26O5Si — CID 11278837
(1S,2R,5S,6R,7R,9R)-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one (PubChem CID 11278837) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R,9R)-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one.
| Compound Name | (1S,2R,5S,6R,7R,9R)-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
|---|---|
| PubChem CID | 11278837 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1S,2R,5S,6R,7R,9R)-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H]3[C@H]4C(=O)O[C@@H]([C@@H]2O1)[C@@H]34 |
| InChI | InChI=1S/C16H26O5Si/c1-15(2,3)22(16(4,5)6)18-7-8-11(21-22)13-9-10(12(9)19-8)14(17)20-13/h8-13H,7H2,1-6H3/t8-,9-,10+,11-,12-,13-/m1/s1 |
| InChIKey | PAUJUMUVQXIEHL-OJEZURLMSA-N |
| XLogP | 2.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|