C9H10O5 — CID 58620373
(2R,5S,6R,9R)-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one (PubChem CID 58620373) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is (2R,5S,6R,9R)-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one.
| Compound Name | (2R,5S,6R,9R)-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
|---|---|
| PubChem CID | 58620373 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2R,5S,6R,9R)-3,8,11,13-tetraoxatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
| SMILES | O=C1O[C@H]2C3OCOC[C@H]3OC3[C@H]2[C@H]13 |
| InChI | InChI=1S/C9H10O5/c10-9-5-4-7(5)13-3-1-11-2-12-6(3)8(4)14-9/h3-8H,1-2H2/t3-,4-,5+,6?,7?,8-/m1/s1 |
| InChIKey | KXMCEURBNSUSQD-HQLVQHBFSA-N |
| XLogP | -0.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |