C16H24O7 — CID 11174834
[(4aS,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyl-2-oxo-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-4-yl] acetate (PubChem CID 11174834) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(4aS,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyl-2-oxo-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-4-yl] acetate.
| Compound Name | [(4aS,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyl-2-oxo-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-4-yl] acetate |
|---|---|
| PubChem CID | 11174834 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(4aS,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyl-2-oxo-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-4-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)O[C@H]2CC[C@@](C)([C@H]3COC(C)(C)O3)O[C@H]12 |
| InChI | InChI=1S/C16H24O7/c1-9(17)20-11-7-13(18)21-10-5-6-16(4,23-14(10)11)12-8-19-15(2,3)22-12/h10-12,14H,5-8H2,1-4H3/t10-,11?,12+,14-,16-/m0/s1 |
| InChIKey | INMPVWYGZBKVLE-QSEZEIQTSA-N |
| XLogP | 1.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |