C19H24O12 — CID 137303048
[(1R,2R,5S,9R,10S,11S)-9,10,11-triacetyloxy-3-oxo-4,7,12-trioxatricyclo[6.3.1.12,5]tridecan-1-yl]methyl acetate (PubChem CID 137303048) has the molecular formula C19H24O12 and a molecular weight of 444.39 g/mol. Its IUPAC name is [(1R,2R,5S,9R,10S,11S)-9,10,11-triacetyloxy-3-oxo-4,7,12-trioxatricyclo[6.3.1.12,5]tridecan-1-yl]methyl acetate.
| Compound Name | [(1R,2R,5S,9R,10S,11S)-9,10,11-triacetyloxy-3-oxo-4,7,12-trioxatricyclo[6.3.1.12,5]tridecan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 137303048 |
| Molecular Formula | C19H24O12 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [(1R,2R,5S,9R,10S,11S)-9,10,11-triacetyloxy-3-oxo-4,7,12-trioxatricyclo[6.3.1.12,5]tridecan-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12OC(OC[C@@H]3C[C@H]1C(=O)O3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C19H24O12/c1-8(20)26-7-19-13-5-12(30-17(13)24)6-25-18(31-19)15(28-10(3)22)14(27-9(2)21)16(19)29-11(4)23/h12-16,18H,5-7H2,1-4H3/t12-,13-,14+,15+,16-,18?,19-/m0/s1 |
| InChIKey | YZQWDXSRWGUROY-GYGHXFBJSA-N |
| XLogP | -0.60 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|