C29H54O7 — CID 59976215
4,7-dimethoxy-6-[(4S)-3-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotridecan-2-one (PubChem CID 59976215) has the molecular formula C29H54O7 and a molecular weight of 514.74 g/mol. Its IUPAC name is 4,7-dimethoxy-6-[(4S)-3-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotridecan-2-one.
| Compound Name | 4,7-dimethoxy-6-[(4S)-3-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotridecan-2-one |
|---|---|
| PubChem CID | 59976215 |
| Molecular Formula | C29H54O7 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | 4,7-dimethoxy-6-[(4S)-3-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotridecan-2-one |
| SMILES | COC1C(C)C(=O)OC(C)C(C)C(C)CC(C)CC(C)(OC)C(OC2OC(C)C[C@H](C)C2OC)C1C |
| InChI | InChI=1S/C29H54O7/c1-16-13-17(2)20(5)23(8)35-27(30)22(7)25(32-11)21(6)26(29(9,15-16)33-12)36-28-24(31-10)18(3)14-19(4)34-28/h16-26,28H,13-15H2,1-12H3/t16?,17?,18-,19?,20?,21?,22?,23?,24?,25?,26?,28?,29?/m0/s1 |
| InChIKey | ZJWGALJYKVXMIA-AYNDDPHNSA-N |
| XLogP | 5.48 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |