C17H28O7 — CID 134867286
methyl 3-(2,4,4a,6,8,8,8a-heptamethyl-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxopropanoate (PubChem CID 134867286) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl 3-(2,4,4a,6,8,8,8a-heptamethyl-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxopropanoate.
| Compound Name | methyl 3-(2,4,4a,6,8,8,8a-heptamethyl-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 134867286 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 3-(2,4,4a,6,8,8,8a-heptamethyl-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxopropanoate |
| SMILES | COC(=O)C(=O)CC1(C)OC(C)OC2(C)C(C)(C)OC(C)OC12C |
| InChI | InChI=1S/C17H28O7/c1-10-21-14(3,4)16(6)17(7,24-10)15(5,22-11(2)23-16)9-12(18)13(19)20-8/h10-11H,9H2,1-8H3 |
| InChIKey | OYQLARBRSKIQGN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|