C15H24O5 — CID 11161899
(4R,4aR,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-one (PubChem CID 11161899) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (4R,4aR,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-one.
| Compound Name | (4R,4aR,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 11161899 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4R,4aR,6S,8aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-one |
| SMILES | C[C@@H]1CC(=O)O[C@H]2CC[C@@](C)([C@H]3COC(C)(C)O3)O[C@H]12 |
| InChI | InChI=1S/C15H24O5/c1-9-7-12(16)18-10-5-6-15(4,20-13(9)10)11-8-17-14(2,3)19-11/h9-11,13H,5-8H2,1-4H3/t9-,10+,11-,13-,15+/m1/s1 |
| InChIKey | NAOBHPBXDMYVDO-QEECANNPSA-N |
| XLogP | 2.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |